C5H10N2O3S — CID 22342009
2-[(2-aminoacetyl)amino]-3-sulfanylpropanoic acid (PubChem CID 22342009) has the molecular formula C5H10N2O3S and a molecular weight of 178.21 g/mol. Its IUPAC name is 2-[(2-aminoacetyl)amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[(2-aminoacetyl)amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 22342009 |
| Molecular Formula | C5H10N2O3S |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | 2-[(2-aminoacetyl)amino]-3-sulfanylpropanoic acid |
| SMILES | NCC(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C5H10N2O3S/c6-1-4(8)7-3(2-11)5(9)10/h3,11H,1-2,6H2,(H,7,8)(H,9,10) |
| InChIKey | MFBYPDKTAJXHNI-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|