C6H13N3O2S — CID 154978208
(2R)-2-[(2-aminoacetyl)amino]-N-methyl-3-sulfanylpropanamide (PubChem CID 154978208) has the molecular formula C6H13N3O2S and a molecular weight of 191.26 g/mol. Its IUPAC name is (2R)-2-[(2-aminoacetyl)amino]-N-methyl-3-sulfanylpropanamide.
| Compound Name | (2R)-2-[(2-aminoacetyl)amino]-N-methyl-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 154978208 |
| Molecular Formula | C6H13N3O2S |
| Molecular Weight | 191.26 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | (2R)-2-[(2-aminoacetyl)amino]-N-methyl-3-sulfanylpropanamide |
| SMILES | CNC(=O)[C@H](CS)NC(=O)CN |
| InChI | InChI=1S/C6H13N3O2S/c1-8-6(11)4(3-12)9-5(10)2-7/h4,12H,2-3,7H2,1H3,(H,8,11)(H,9,10)/t4-/m0/s1 |
| InChIKey | OADRRKRVCQLULS-BYPYZUCNSA-N |
| XLogP | -1.89 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.26 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|