C8H15N3O4S — CID 18220896
2-[2-[(2-aminoacetyl)amino]propanoylamino]-3-sulfanylpropanoic acid (PubChem CID 18220896) has the molecular formula C8H15N3O4S and a molecular weight of 249.29 g/mol. Its IUPAC name is 2-[2-[(2-aminoacetyl)amino]propanoylamino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[2-[(2-aminoacetyl)amino]propanoylamino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18220896 |
| Molecular Formula | C8H15N3O4S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 2-[2-[(2-aminoacetyl)amino]propanoylamino]-3-sulfanylpropanoic acid |
| SMILES | CC(NC(=O)CN)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C8H15N3O4S/c1-4(10-6(12)2-9)7(13)11-5(3-16)8(14)15/h4-5,16H,2-3,9H2,1H3,(H,10,12)(H,11,13)(H,14,15) |
| InChIKey | GQGAFTPXAPKSCF-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|