C14H26N4O5S — CID 18484931
2-[[2-[2-[(2-aminoacetyl)amino]propanoylamino]-3-methylpentanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18484931) has the molecular formula C14H26N4O5S and a molecular weight of 362.45 g/mol. Its IUPAC name is 2-[[2-[2-[(2-aminoacetyl)amino]propanoylamino]-3-methylpentanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[2-[(2-aminoacetyl)amino]propanoylamino]-3-methylpentanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18484931 |
| Molecular Formula | C14H26N4O5S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 2-[[2-[2-[(2-aminoacetyl)amino]propanoylamino]-3-methylpentanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CCC(C)C(NC(=O)C(C)NC(=O)CN)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C14H26N4O5S/c1-4-7(2)11(13(21)17-9(6-24)14(22)23)18-12(20)8(3)16-10(19)5-15/h7-9,11,24H,4-6,15H2,1-3H3,(H,16,19)(H,17,21)(H,18,20)(H,22,23) |
| InChIKey | KSOKXOIXOLHAMS-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|