C15H26N4O7S — CID 18488368
2-[[2-[[2-[(2-aminoacetyl)amino]-3-methylpentanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid (PubChem CID 18488368) has the molecular formula C15H26N4O7S and a molecular weight of 406.46 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-aminoacetyl)amino]-3-methylpentanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-aminoacetyl)amino]-3-methylpentanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18488368 |
| Molecular Formula | C15H26N4O7S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 2-[[2-[[2-[(2-aminoacetyl)amino]-3-methylpentanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid |
| SMILES | CCC(C)C(NC(=O)CN)C(=O)NC(CS)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H26N4O7S/c1-3-7(2)12(19-10(20)5-16)14(24)18-9(6-27)13(23)17-8(15(25)26)4-11(21)22/h7-9,12,27H,3-6,16H2,1-2H3,(H,17,23)(H,18,24)(H,19,20)(H,21,22)(H,25,26) |
| InChIKey | FPVWZSZNUSMQFW-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 187.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|