C11H20N2O4S — CID 175709227
(2R)-2-[[(2S,3S)-2-acetamido-3-methylpentanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 175709227) has the molecular formula C11H20N2O4S and a molecular weight of 276.36 g/mol. Its IUPAC name is (2R)-2-[[(2S,3S)-2-acetamido-3-methylpentanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[[(2S,3S)-2-acetamido-3-methylpentanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 175709227 |
| Molecular Formula | C11H20N2O4S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | (2R)-2-[[(2S,3S)-2-acetamido-3-methylpentanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(C)=O)C(=O)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C11H20N2O4S/c1-4-6(2)9(12-7(3)14)10(15)13-8(5-18)11(16)17/h6,8-9,18H,4-5H2,1-3H3,(H,12,14)(H,13,15)(H,16,17)/t6-,8-,9-/m0/s1 |
| InChIKey | RCMNWLJUYCMVLD-XVYDVKMFSA-N |
| XLogP | 0.04 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|