C15H27N3O9S3 — CID 87596071
(2S)-2-acetamido-3-sulfanylpropanoic acid;bis((2R)-2-acetamido-3-sulfanylpropanoic acid) (PubChem CID 87596071) has the molecular formula C15H27N3O9S3 and a molecular weight of 489.59 g/mol. Its IUPAC name is (2S)-2-acetamido-3-sulfanylpropanoic acid;bis((2R)-2-acetamido-3-sulfanylpropanoic acid).
| Compound Name | (2S)-2-acetamido-3-sulfanylpropanoic acid;bis((2R)-2-acetamido-3-sulfanylpropanoic acid) |
|---|---|
| PubChem CID | 87596071 |
| Molecular Formula | C15H27N3O9S3 |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | (2S)-2-acetamido-3-sulfanylpropanoic acid;bis((2R)-2-acetamido-3-sulfanylpropanoic acid) |
| SMILES | CC(=O)N[C@@H](CS)C(=O)O.CC(=O)N[C@@H](CS)C(=O)O.CC(=O)N[C@H](CS)C(=O)O |
| InChI | InChI=1S/3C5H9NO3S/c3*1-3(7)6-4(2-10)5(8)9/h3*4,10H,2H2,1H3,(H,6,7)(H,8,9)/t3*4-/m100/s1 |
| InChIKey | DHVAKDKERMADKY-PTWGOLBCSA-N |
| XLogP | -1.48 |
| TPSA | 199.20 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|