C5H12N2O3S — CID 14369897
2-acetamido-3-sulfanylpropanoic acid;azane (PubChem CID 14369897) has the molecular formula C5H12N2O3S and a molecular weight of 180.23 g/mol. Its IUPAC name is 2-acetamido-3-sulfanylpropanoic acid;azane.
| Compound Name | 2-acetamido-3-sulfanylpropanoic acid;azane |
|---|---|
| PubChem CID | 14369897 |
| Molecular Formula | C5H12N2O3S |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 2-acetamido-3-sulfanylpropanoic acid;azane |
| SMILES | CC(=O)NC(CS)C(=O)O.N |
| InChI | InChI=1S/C5H9NO3S.H3N/c1-3(7)6-4(2-10)5(8)9;/h4,10H,2H2,1H3,(H,6,7)(H,8,9);1H3 |
| InChIKey | RFLFZJJUEFPEPN-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|