C5H10LiNO3S — CID 175290404
lithium;(2R)-2-acetamido-3-sulfanylpropanoic acid;hydride (PubChem CID 175290404) has the molecular formula C5H10LiNO3S and a molecular weight of 171.15 g/mol. Its IUPAC name is lithium;(2R)-2-acetamido-3-sulfanylpropanoic acid;hydride.
| Compound Name | lithium;(2R)-2-acetamido-3-sulfanylpropanoic acid;hydride |
|---|---|
| PubChem CID | 175290404 |
| Molecular Formula | C5H10LiNO3S |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | lithium;(2R)-2-acetamido-3-sulfanylpropanoic acid;hydride |
| SMILES | CC(=O)N[C@@H](CS)C(=O)O.[H-].[Li+] |
| InChI | InChI=1S/C5H9NO3S.Li.H/c1-3(7)6-4(2-10)5(8)9;;/h4,10H,2H2,1H3,(H,6,7)(H,8,9);;/q;+1;-1/t4-;;/m0../s1 |
| InChIKey | PZJGXORCUGSHLR-FHNDMYTFSA-N |
| XLogP | -3.38 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|