C8H16N2O6S — CID 155273306
2-acetamido-3-hydroxypropanoic acid;2-amino-3-sulfanylpropanoic acid (PubChem CID 155273306) has the molecular formula C8H16N2O6S and a molecular weight of 268.29 g/mol. Its IUPAC name is 2-acetamido-3-hydroxypropanoic acid;2-amino-3-sulfanylpropanoic acid.
| Compound Name | 2-acetamido-3-hydroxypropanoic acid;2-amino-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 155273306 |
| Molecular Formula | C8H16N2O6S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 2-acetamido-3-hydroxypropanoic acid;2-amino-3-sulfanylpropanoic acid |
| SMILES | CC(=O)NC(CO)C(=O)O.NC(CS)C(=O)O |
| InChI | InChI=1S/C5H9NO4.C3H7NO2S/c1-3(8)6-4(2-7)5(9)10;4-2(1-7)3(5)6/h4,7H,2H2,1H3,(H,6,8)(H,9,10);2,7H,1,4H2,(H,5,6) |
| InChIKey | XYLBVPLNZCPVON-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|