C6H14N2O5S — CID 87207256
(2S)-2-amino-3-hydroxypropanoic acid;(2R)-2-amino-3-sulfanylpropanoic acid (PubChem CID 87207256) has the molecular formula C6H14N2O5S and a molecular weight of 226.25 g/mol. Its IUPAC name is (2S)-2-amino-3-hydroxypropanoic acid;(2R)-2-amino-3-sulfanylpropanoic acid.
| Compound Name | (2S)-2-amino-3-hydroxypropanoic acid;(2R)-2-amino-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 87207256 |
| Molecular Formula | C6H14N2O5S |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | (2S)-2-amino-3-hydroxypropanoic acid;(2R)-2-amino-3-sulfanylpropanoic acid |
| SMILES | N[C@@H](CO)C(=O)O.N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C3H7NO3.C3H7NO2S/c4-2(1-5)3(6)7;4-2(1-7)3(5)6/h2,5H,1,4H2,(H,6,7);2,7H,1,4H2,(H,5,6)/t2*2-/m00/s1 |
| InChIKey | IZRRYEWBKJOZIG-BXRBKJIMSA-N |
| XLogP | -2.28 |
| TPSA | 146.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|