C3H7NO3 — CID 71309922
(2S)-2-amino-3-hydroxy(1,2,3-13C3)propanoic acid (PubChem CID 71309922) has the molecular formula C3H7NO3 and a molecular weight of 108.07 g/mol. Its IUPAC name is (2S)-2-amino-3-hydroxy(1,2,3-13C3)propanoic acid.
| Compound Name | (2S)-2-amino-3-hydroxy(1,2,3-13C3)propanoic acid |
|---|---|
| PubChem CID | 71309922 |
| Molecular Formula | C3H7NO3 |
| Molecular Weight | 108.07 g/mol |
| Exact Mass | 108.05 |
| IUPAC Name | (2S)-2-amino-3-hydroxy(1,2,3-13C3)propanoic acid |
| SMILES | N[13C@@H]([13CH2]O)[13C](=O)O |
| InChI | InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m0/s1/i1+1,2+1,3+1 |
| InChIKey | MTCFGRXMJLQNBG-GCCOVPGMSA-N |
| XLogP | -1.61 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 108.07 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |