C3H11N2O6P — CID 118456390
2-amino-3-hydroxypropanoic acid;aminophosphonic acid (PubChem CID 118456390) has the molecular formula C3H11N2O6P and a molecular weight of 202.10 g/mol. Its IUPAC name is 2-amino-3-hydroxypropanoic acid;aminophosphonic acid.
| Compound Name | 2-amino-3-hydroxypropanoic acid;aminophosphonic acid |
|---|---|
| PubChem CID | 118456390 |
| Molecular Formula | C3H11N2O6P |
| Molecular Weight | 202.10 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 2-amino-3-hydroxypropanoic acid;aminophosphonic acid |
| SMILES | NC(CO)C(=O)O.NP(=O)(O)O |
| InChI | InChI=1S/C3H7NO3.H4NO3P/c4-2(1-5)3(6)7;1-5(2,3)4/h2,5H,1,4H2,(H,6,7);(H4,1,2,3,4) |
| InChIKey | HXHQMRWSYMYZDT-UHFFFAOYSA-N |
| XLogP | -2.57 |
| TPSA | 167.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.10 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|