C5H15N2O7P — CID 87229124
(2-amino-1-hydroxyethyl)phosphonic acid;(2S)-2-amino-3-hydroxypropanoic acid (PubChem CID 87229124) has the molecular formula C5H15N2O7P and a molecular weight of 246.16 g/mol. Its IUPAC name is (2-amino-1-hydroxyethyl)phosphonic acid;(2S)-2-amino-3-hydroxypropanoic acid.
| Compound Name | (2-amino-1-hydroxyethyl)phosphonic acid;(2S)-2-amino-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 87229124 |
| Molecular Formula | C5H15N2O7P |
| Molecular Weight | 246.16 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | (2-amino-1-hydroxyethyl)phosphonic acid;(2S)-2-amino-3-hydroxypropanoic acid |
| SMILES | NCC(O)P(=O)(O)O.N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C3H7NO3.C2H8NO4P/c4-2(1-5)3(6)7;3-1-2(4)8(5,6)7/h2,5H,1,4H2,(H,6,7);2,4H,1,3H2,(H2,5,6,7)/t2-;/m0./s1 |
| InChIKey | BXSFTTCZUIBDNT-DKWTVANSSA-N |
| XLogP | -3.17 |
| TPSA | 187.33 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.16 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|