C10H21N3O10 — CID 162130490
(2S)-2-aminobutanedioic acid;bis((2S)-2-amino-3-hydroxypropanoic acid) (PubChem CID 162130490) has the molecular formula C10H21N3O10 and a molecular weight of 343.29 g/mol. Its IUPAC name is (2S)-2-aminobutanedioic acid;bis((2S)-2-amino-3-hydroxypropanoic acid).
| Compound Name | (2S)-2-aminobutanedioic acid;bis((2S)-2-amino-3-hydroxypropanoic acid) |
|---|---|
| PubChem CID | 162130490 |
| Molecular Formula | C10H21N3O10 |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | (2S)-2-aminobutanedioic acid;bis((2S)-2-amino-3-hydroxypropanoic acid) |
| SMILES | N[C@@H](CC(=O)O)C(=O)O.N[C@@H](CO)C(=O)O.N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C4H7NO4.2C3H7NO3/c5-2(4(8)9)1-3(6)7;2*4-2(1-5)3(6)7/h2H,1,5H2,(H,6,7)(H,8,9);2*2,5H,1,4H2,(H,6,7)/t3*2-/m000/s1 |
| InChIKey | ZIPFBKRFIGPTKY-NYIJDJKZSA-N |
| XLogP | -4.35 |
| TPSA | 267.72 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | -4.35 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |