About 2-aminobutanedioic acid;molybdenum
2-aminobutanedioic acid;molybdenum (PubChem CID 76550864) has the molecular formula C4H7MoNO4
and a molecular weight of 229.04 g/mol. Its IUPAC name is 2-aminobutanedioic acid;molybdenum.
Molecular Properties
| Compound Name | 2-aminobutanedioic acid;molybdenum |
| PubChem CID | 76550864 |
| Molecular Formula | C4H7MoNO4 |
| Molecular Weight | 229.04 g/mol |
| Exact Mass | 230.94 |
| IUPAC Name | 2-aminobutanedioic acid;molybdenum |
| SMILES | NC(CC(=O)O)C(=O)O.[Mo] |
| InChI | InChI=1S/C4H7NO4.Mo/c5-2(4(8)9)1-3(6)7;/h2H,1,5H2,(H,6,7)(H,8,9); |
| InChIKey | CUIZJNYULDUVTJ-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.04 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-aminobutanedioic acid;molybdenum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobutanedioic acid;molybdenum?
The IUPAC name of 2-aminobutanedioic acid;molybdenum (CID 76550864) is 2-aminobutanedioic acid;molybdenum.
What is the SMILES notation for 2-aminobutanedioic acid;molybdenum?
The canonical SMILES for 2-aminobutanedioic acid;molybdenum is NC(CC(=O)O)C(=O)O.[Mo].
What is the InChIKey of 2-aminobutanedioic acid;molybdenum?
The InChIKey is CUIZJNYULDUVTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO4.Mo/c5-2(4(8)9)1-3(6)7;/h2H,1,5H2,(H,6,7)(H,8,9);.
What are the key properties of 2-aminobutanedioic acid;molybdenum?
2-aminobutanedioic acid;molybdenum has a molecular weight of 229.04 g/mol, XLogP of -1.13, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobutanedioic acid;molybdenum is sourced from PubChem (CID 76550864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).