About CID 173060561
CID 173060561 (PubChem CID 173060561) has the molecular formula C4H9ClN2O4
and a molecular weight of 184.58 g/mol.
Molecular Properties
| Compound Name | CID 173060561 |
| PubChem CID | 173060561 |
| Molecular Formula | C4H9ClN2O4 |
| Molecular Weight | 184.58 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | — |
| SMILES | NCl.N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C4H7NO4.ClH2N/c5-2(4(8)9)1-3(6)7;1-2/h2H,1,5H2,(H,6,7)(H,8,9);2H2/t2-;/m0./s1 |
| InChIKey | UAQZHTUXTLIOAM-DKWTVANSSA-N |
| XLogP | -1.03 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.58 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze CID 173060561 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173060561?
The IUPAC name of CID 173060561 (CID 173060561) is not available.
What is the SMILES notation for CID 173060561?
The canonical SMILES for CID 173060561 is NCl.N[C@@H](CC(=O)O)C(=O)O.
What is the InChIKey of CID 173060561?
The InChIKey is UAQZHTUXTLIOAM-DKWTVANSSA-N. The full InChI is InChI=1S/C4H7NO4.ClH2N/c5-2(4(8)9)1-3(6)7;1-2/h2H,1,5H2,(H,6,7)(H,8,9);2H2/t2-;/m0./s1.
What are the key properties of CID 173060561?
CID 173060561 has a molecular weight of 184.58 g/mol, XLogP of -1.03, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173060561 is sourced from PubChem (CID 173060561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).