About CID 131864134
CID 131864134 (PubChem CID 131864134) has the molecular formula C8H14CaN2O8
and a molecular weight of 306.28 g/mol.
Molecular Properties
| Compound Name | CID 131864134 |
| PubChem CID | 131864134 |
| Molecular Formula | C8H14CaN2O8 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | — |
| SMILES | NC(CC(=O)O)C(=O)O.NC(CC(=O)O)C(=O)O.[Ca] |
| InChI | InChI=1S/2C4H7NO4.Ca/c2*5-2(4(8)9)1-3(6)7;/h2*2H,1,5H2,(H,6,7)(H,8,9); |
| InChIKey | REXCGUADDHENOV-UHFFFAOYSA-N |
| XLogP | -2.63 |
| TPSA | 201.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 131864134 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131864134?
The IUPAC name of CID 131864134 (CID 131864134) is not available.
What is the SMILES notation for CID 131864134?
The canonical SMILES for CID 131864134 is NC(CC(=O)O)C(=O)O.NC(CC(=O)O)C(=O)O.[Ca].
What is the InChIKey of CID 131864134?
The InChIKey is REXCGUADDHENOV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H7NO4.Ca/c2*5-2(4(8)9)1-3(6)7;/h2*2H,1,5H2,(H,6,7)(H,8,9);.
What are the key properties of CID 131864134?
CID 131864134 has a molecular weight of 306.28 g/mol, XLogP of -2.63, 6 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131864134 is sourced from PubChem (CID 131864134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).