C6H17N2O7P — CID 21126144
2,6-diamino-5-hydroxyhexanoic acid;phosphoric acid (PubChem CID 21126144) has the molecular formula C6H17N2O7P and a molecular weight of 260.18 g/mol. Its IUPAC name is 2,6-diamino-5-hydroxyhexanoic acid;phosphoric acid.
| Compound Name | 2,6-diamino-5-hydroxyhexanoic acid;phosphoric acid |
|---|---|
| PubChem CID | 21126144 |
| Molecular Formula | C6H17N2O7P |
| Molecular Weight | 260.18 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 2,6-diamino-5-hydroxyhexanoic acid;phosphoric acid |
| SMILES | NCC(O)CCC(N)C(=O)O.O=P(O)(O)O |
| InChI | InChI=1S/C6H14N2O3.H3O4P/c7-3-4(9)1-2-5(8)6(10)11;1-5(2,3)4/h4-5,9H,1-3,7-8H2,(H,10,11);(H3,1,2,3,4) |
| InChIKey | KSHGDGLJAGEBQA-UHFFFAOYSA-N |
| XLogP | -2.43 |
| TPSA | 187.33 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.18 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|