C12H26N2O9 — CID 175432317
2,6-diamino-5-hydroxyhexanoic acid;2,3,4,5,6-pentahydroxyhexanal (PubChem CID 175432317) has the molecular formula C12H26N2O9 and a molecular weight of 342.35 g/mol. Its IUPAC name is 2,6-diamino-5-hydroxyhexanoic acid;2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | 2,6-diamino-5-hydroxyhexanoic acid;2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 175432317 |
| Molecular Formula | C12H26N2O9 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 2,6-diamino-5-hydroxyhexanoic acid;2,3,4,5,6-pentahydroxyhexanal |
| SMILES | NCC(O)CCC(N)C(=O)O.O=CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H14N2O3.C6H12O6/c7-3-4(9)1-2-5(8)6(10)11;7-1-3(9)5(11)6(12)4(10)2-8/h4-5,9H,1-3,7-8H2,(H,10,11);1,3-6,8-12H,2H2 |
| InChIKey | TUZKCRBMXQEFNQ-UHFFFAOYSA-N |
| XLogP | -4.88 |
| TPSA | 227.79 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | -4.88 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|