C8H17NO8 — CID 87367156
2-aminoacetic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal (PubChem CID 87367156) has the molecular formula C8H17NO8 and a molecular weight of 255.22 g/mol. Its IUPAC name is 2-aminoacetic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | 2-aminoacetic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 87367156 |
| Molecular Formula | C8H17NO8 |
| Molecular Weight | 255.22 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 2-aminoacetic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
| SMILES | NCC(=O)O.O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O6.C2H5NO2/c7-1-3(9)5(11)6(12)4(10)2-8;3-1-2(4)5/h1,3-6,8-12H,2H2;1,3H2,(H,4,5)/t3-,4+,5+,6+;/m0./s1 |
| InChIKey | BCWAYSFBQDPDIG-BTVCFUMJSA-N |
| XLogP | -4.35 |
| TPSA | 181.54 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.22 |
| LogP ≤ 5 | -4.35 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|