C12H26O12 — CID 87772987
(2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol;(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal (PubChem CID 87772987) has the molecular formula C12H26O12 and a molecular weight of 362.33 g/mol. Its IUPAC name is (2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol;(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | (2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol;(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 87772987 |
| Molecular Formula | C12H26O12 |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol;(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
| SMILES | O=C[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H14O6.C6H12O6/c2*7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2;1,3-6,8-12H,2H2/t2*3-,4-,5-,6-/m11/s1 |
| InChIKey | LTSFKYMMVSEWPP-KZXKDKCNSA-N |
| XLogP | -6.96 |
| TPSA | 239.60 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | -6.96 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|