C6H13BrO6 — CID 174381497
2,3,4,5,6-pentahydroxyhexanal;hydrobromide (PubChem CID 174381497) has the molecular formula C6H13BrO6 and a molecular weight of 261.07 g/mol. Its IUPAC name is 2,3,4,5,6-pentahydroxyhexanal;hydrobromide.
| Compound Name | 2,3,4,5,6-pentahydroxyhexanal;hydrobromide |
|---|---|
| PubChem CID | 174381497 |
| Molecular Formula | C6H13BrO6 |
| Molecular Weight | 261.07 g/mol |
| Exact Mass | 259.99 |
| IUPAC Name | 2,3,4,5,6-pentahydroxyhexanal;hydrobromide |
| SMILES | Br.O=CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H12O6.BrH/c7-1-3(9)5(11)6(12)4(10)2-8;/h1,3-6,8-12H,2H2;1H |
| InChIKey | QWMHJRQNEVHLGK-UHFFFAOYSA-N |
| XLogP | -2.80 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.07 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|