C6H12AgO6 — CID 174703669
2,3,4,5,6-pentahydroxyhexanal;silver (PubChem CID 174703669) has the molecular formula C6H12AgO6 and a molecular weight of 288.02 g/mol. Its IUPAC name is 2,3,4,5,6-pentahydroxyhexanal;silver.
| Compound Name | 2,3,4,5,6-pentahydroxyhexanal;silver |
|---|---|
| PubChem CID | 174703669 |
| Molecular Formula | C6H12AgO6 |
| Molecular Weight | 288.02 g/mol |
| Exact Mass | 286.97 |
| IUPAC Name | 2,3,4,5,6-pentahydroxyhexanal;silver |
| SMILES | O=CC(O)C(O)C(O)C(O)CO.[Ag] |
| InChI | InChI=1S/C6H12O6.Ag/c7-1-3(9)5(11)6(12)4(10)2-8;/h1,3-6,8-12H,2H2; |
| InChIKey | NLWSIUOIZFEHJP-UHFFFAOYSA-N |
| XLogP | -3.38 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.02 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|