C6H18O9 — CID 174605740
2,3,4,5,6-pentahydroxyhexanal;trihydrate (PubChem CID 174605740) has the molecular formula C6H18O9 and a molecular weight of 234.20 g/mol. Its IUPAC name is 2,3,4,5,6-pentahydroxyhexanal;trihydrate.
| Compound Name | 2,3,4,5,6-pentahydroxyhexanal;trihydrate |
|---|---|
| PubChem CID | 174605740 |
| Molecular Formula | C6H18O9 |
| Molecular Weight | 234.20 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 2,3,4,5,6-pentahydroxyhexanal;trihydrate |
| SMILES | O.O.O.O=CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H12O6.3H2O/c7-1-3(9)5(11)6(12)4(10)2-8;;;/h1,3-6,8-12H,2H2;3*1H2 |
| InChIKey | RXJCAXMOLAHRDS-UHFFFAOYSA-N |
| XLogP | -5.85 |
| TPSA | 212.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.20 |
| LogP ≤ 5 | -5.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|