C6H12O6 — CID 3037556
(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanal (PubChem CID 3037556) has the molecular formula C6H12O6 and a molecular weight of 180.16 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 3037556 |
| Molecular Formula | C6H12O6 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanal |
| SMILES | O=C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4+,5+,6-/m0/s1 |
| InChIKey | GZCGUPFRVQAUEE-KCDKBNATSA-N |
| XLogP | -3.38 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|