C7H16O6 — CID 175873385
methane;(2S,3R,4S,5S)-2,3,4,5,6-pentahydroxyhexanal (PubChem CID 175873385) has the molecular formula C7H16O6 and a molecular weight of 196.20 g/mol. Its IUPAC name is methane;(2S,3R,4S,5S)-2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | methane;(2S,3R,4S,5S)-2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 175873385 |
| Molecular Formula | C7H16O6 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | methane;(2S,3R,4S,5S)-2,3,4,5,6-pentahydroxyhexanal |
| SMILES | C.O=C[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C6H12O6.CH4/c7-1-3(9)5(11)6(12)4(10)2-8;/h1,3-6,8-12H,2H2;1H4/t3-,4+,5+,6+;/m1./s1 |
| InChIKey | OPVJPIBTMWSWAF-QGROCUHESA-N |
| XLogP | -2.74 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|