C12H18O6 — CID 161438638
benzene;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal (PubChem CID 161438638) has the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. Its IUPAC name is benzene;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | benzene;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 161438638 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | benzene;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
| SMILES | O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.c1ccccc1 |
| InChI | InChI=1S/C6H12O6.C6H6/c7-1-3(9)5(11)6(12)4(10)2-8;1-2-4-6-5-3-1/h1,3-6,8-12H,2H2;1-6H/t3-,4+,5+,6+;/m0./s1 |
| InChIKey | VYYZRCMPYJUUJA-BTVCFUMJSA-N |
| XLogP | -1.69 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|