C9H16O10 — CID 157232037
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;propanedioic acid (PubChem CID 157232037) has the molecular formula C9H16O10 and a molecular weight of 284.22 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;propanedioic acid.
| Compound Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;propanedioic acid |
|---|---|
| PubChem CID | 157232037 |
| Molecular Formula | C9H16O10 |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;propanedioic acid |
| SMILES | O=C(O)CC(=O)O.O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O6.C3H4O4/c7-1-3(9)5(11)6(12)4(10)2-8;4-2(5)1-3(6)7/h1,3-6,8-12H,2H2;1H2,(H,4,5)(H,6,7)/t3-,4+,5+,6+;/m0./s1 |
| InChIKey | AUFGMNSLVULYPF-BTVCFUMJSA-N |
| XLogP | -3.83 |
| TPSA | 192.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | -3.83 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|