C18H36O18 — CID 173049059
acetic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;(2S,3R,4R)-2,3,4,5-tetrahydroxypentanal;(2R,3S,4R)-2,3,4,5-tetrahydroxypentanal (PubChem CID 173049059) has the molecular formula C18H36O18 and a molecular weight of 540.47 g/mol. Its IUPAC name is acetic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;(2S,3R,4R)-2,3,4,5-tetrahydroxypentanal;(2R,3S,4R)-2,3,4,5-tetrahydroxypentanal.
| Compound Name | acetic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;(2S,3R,4R)-2,3,4,5-tetrahydroxypentanal;(2R,3S,4R)-2,3,4,5-tetrahydroxypentanal |
|---|---|
| PubChem CID | 173049059 |
| Molecular Formula | C18H36O18 |
| Molecular Weight | 540.47 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | acetic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;(2S,3R,4R)-2,3,4,5-tetrahydroxypentanal;(2R,3S,4R)-2,3,4,5-tetrahydroxypentanal |
| SMILES | CC(=O)O.O=C[C@@H](O)[C@H](O)[C@H](O)CO.O=C[C@H](O)[C@@H](O)[C@H](O)CO.O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O6.2C5H10O5.C2H4O2/c7-1-3(9)5(11)6(12)4(10)2-8;2*6-1-3(8)5(10)4(9)2-7;1-2(3)4/h1,3-6,8-12H,2H2;2*1,3-5,7-10H,2H2;1H3,(H,3,4)/t3-,4+,5+,6+;3-,4+,5+;3-,4-,5+;/m001./s1 |
| InChIKey | KINITSWMMZXRRI-UEPRWJKASA-N |
| XLogP | -8.77 |
| TPSA | 351.50 Ų |
| H-Bond Donors | 14 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.47 |
| LogP ≤ 5 | -8.77 |
| H-Bond Donors ≤ 5 | 14 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|