C10H18CaO10 — CID 163677302
calcium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;diacetate (PubChem CID 163677302) has the molecular formula C10H18CaO10 and a molecular weight of 338.32 g/mol. Its IUPAC name is calcium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;diacetate.
| Compound Name | calcium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;diacetate |
|---|---|
| PubChem CID | 163677302 |
| Molecular Formula | C10H18CaO10 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | calcium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;diacetate |
| SMILES | CC(=O)[O-].CC(=O)[O-].O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[Ca+2] |
| InChI | InChI=1S/C6H12O6.2C2H4O2.Ca/c7-1-3(9)5(11)6(12)4(10)2-8;2*1-2(3)4;/h1,3-6,8-12H,2H2;2*1H3,(H,3,4);/q;;;+2/p-2/t3-,4+,5+,6+;;;/m0.../s1 |
| InChIKey | JHUFEKCEFROPOK-YZJMRIMCSA-L |
| XLogP | -6.25 |
| TPSA | 198.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | -6.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|