C8H19NO8 — CID 174736438
acetic acid;azane;2,3,4,5,6-pentahydroxyhexanal (PubChem CID 174736438) has the molecular formula C8H19NO8 and a molecular weight of 257.24 g/mol. Its IUPAC name is acetic acid;azane;2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | acetic acid;azane;2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 174736438 |
| Molecular Formula | C8H19NO8 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | acetic acid;azane;2,3,4,5,6-pentahydroxyhexanal |
| SMILES | CC(=O)O.N.O=CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H12O6.C2H4O2.H3N/c7-1-3(9)5(11)6(12)4(10)2-8;1-2(3)4;/h1,3-6,8-12H,2H2;1H3,(H,3,4);1H3 |
| InChIKey | SNSKUMZQFFNZFN-UHFFFAOYSA-N |
| XLogP | -3.13 |
| TPSA | 190.52 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|