C6H16ClNO6 — CID 162313091
azane;(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanal;hydrochloride (PubChem CID 162313091) has the molecular formula C6H16ClNO6 and a molecular weight of 233.65 g/mol. Its IUPAC name is azane;(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanal;hydrochloride.
| Compound Name | azane;(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanal;hydrochloride |
|---|---|
| PubChem CID | 162313091 |
| Molecular Formula | C6H16ClNO6 |
| Molecular Weight | 233.65 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | azane;(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanal;hydrochloride |
| SMILES | Cl.N.O=C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O6.ClH.H3N/c7-1-3(9)5(11)6(12)4(10)2-8;;/h1,3-6,8-12H,2H2;1H;1H3/t3-,4+,5+,6-;;/m0../s1 |
| InChIKey | VWMCDPCJFGPNGW-SHQHISBTSA-N |
| XLogP | -2.80 |
| TPSA | 153.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.65 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|