C14H24O10 — CID 174462033
bis(2-methylprop-2-enoic acid);2,3,4,5,6-pentahydroxyhexanal (PubChem CID 174462033) has the molecular formula C14H24O10 and a molecular weight of 352.34 g/mol. Its IUPAC name is bis(2-methylprop-2-enoic acid);2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | bis(2-methylprop-2-enoic acid);2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 174462033 |
| Molecular Formula | C14H24O10 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | bis(2-methylprop-2-enoic acid);2,3,4,5,6-pentahydroxyhexanal |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.O=CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H12O6.2C4H6O2/c7-1-3(9)5(11)6(12)4(10)2-8;2*1-3(2)4(5)6/h1,3-6,8-12H,2H2;2*1H2,2H3,(H,5,6) |
| InChIKey | CVCYKTXEAQWEGM-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 192.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|