C10H19NO7 — CID 87645451
2-methylprop-2-enamide;(2R,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexanal (PubChem CID 87645451) has the molecular formula C10H19NO7 and a molecular weight of 265.26 g/mol. Its IUPAC name is 2-methylprop-2-enamide;(2R,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | 2-methylprop-2-enamide;(2R,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 87645451 |
| Molecular Formula | C10H19NO7 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-methylprop-2-enamide;(2R,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexanal |
| SMILES | C=C(C)C(N)=O.O=C[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O6.C4H7NO/c7-1-3(9)5(11)6(12)4(10)2-8;1-3(2)4(5)6/h1,3-6,8-12H,2H2;1H2,2H3,(H2,5,6)/t3-,4+,5-,6-;/m0./s1 |
| InChIKey | JZUVEANEMAWHQG-WBHXJHRCSA-N |
| XLogP | -3.33 |
| TPSA | 161.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | -3.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|