C8H18N2O8 — CID 175597940
formaldehyde;2,3,4,5,6-pentahydroxyhexanal;urea (PubChem CID 175597940) has the molecular formula C8H18N2O8 and a molecular weight of 270.24 g/mol. Its IUPAC name is formaldehyde;2,3,4,5,6-pentahydroxyhexanal;urea.
| Compound Name | formaldehyde;2,3,4,5,6-pentahydroxyhexanal;urea |
|---|---|
| PubChem CID | 175597940 |
| Molecular Formula | C8H18N2O8 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | formaldehyde;2,3,4,5,6-pentahydroxyhexanal;urea |
| SMILES | C=O.NC(N)=O.O=CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H12O6.CH4N2O.CH2O/c7-1-3(9)5(11)6(12)4(10)2-8;2-1(3)4;1-2/h1,3-6,8-12H,2H2;(H4,2,3,4);1H2 |
| InChIKey | BRDZLJNOSFMEFY-UHFFFAOYSA-N |
| XLogP | -4.54 |
| TPSA | 204.40 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | -4.54 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|