C9H17NO7 — CID 87644411
(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;prop-2-enamide (PubChem CID 87644411) has the molecular formula C9H17NO7 and a molecular weight of 251.23 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;prop-2-enamide.
| Compound Name | (2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;prop-2-enamide |
|---|---|
| PubChem CID | 87644411 |
| Molecular Formula | C9H17NO7 |
| Molecular Weight | 251.23 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | (2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;prop-2-enamide |
| SMILES | C=CC(N)=O.O=C[C@H](O)[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O6.C3H5NO/c7-1-3(9)5(11)6(12)4(10)2-8;1-2-3(4)5/h1,3-6,8-12H,2H2;2H,1H2,(H2,4,5)/t3-,4+,5-,6+;/m0./s1 |
| InChIKey | KTSHKBLUWJVTBB-SLTHYHMUSA-N |
| XLogP | -3.72 |
| TPSA | 161.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.23 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|