C8H15NO6 — CID 87644652
prop-2-enamide;(2S,3R,4R)-2,3,4,5-tetrahydroxypentanal (PubChem CID 87644652) has the molecular formula C8H15NO6 and a molecular weight of 221.21 g/mol. Its IUPAC name is prop-2-enamide;(2S,3R,4R)-2,3,4,5-tetrahydroxypentanal.
| Compound Name | prop-2-enamide;(2S,3R,4R)-2,3,4,5-tetrahydroxypentanal |
|---|---|
| PubChem CID | 87644652 |
| Molecular Formula | C8H15NO6 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | prop-2-enamide;(2S,3R,4R)-2,3,4,5-tetrahydroxypentanal |
| SMILES | C=CC(N)=O.O=C[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C5H10O5.C3H5NO/c6-1-3(8)5(10)4(9)2-7;1-2-3(4)5/h1,3-5,7-10H,2H2;2H,1H2,(H2,4,5)/t3-,4-,5+;/m1./s1 |
| InChIKey | LFGLOQMINDSPFV-ZDQHTEEMSA-N |
| XLogP | -3.08 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|