C16H32O16 — CID 57347809
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;bis((2R,3S,4R)-2,3,4,5-tetrahydroxypentanal) (PubChem CID 57347809) has the molecular formula C16H32O16 and a molecular weight of 480.42 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;bis((2R,3S,4R)-2,3,4,5-tetrahydroxypentanal).
| Compound Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;bis((2R,3S,4R)-2,3,4,5-tetrahydroxypentanal) |
|---|---|
| PubChem CID | 57347809 |
| Molecular Formula | C16H32O16 |
| Molecular Weight | 480.42 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;bis((2R,3S,4R)-2,3,4,5-tetrahydroxypentanal) |
| SMILES | O=C[C@H](O)[C@@H](O)[C@H](O)CO.O=C[C@H](O)[C@@H](O)[C@H](O)CO.O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O6.2C5H10O5/c7-1-3(9)5(11)6(12)4(10)2-8;2*6-1-3(8)5(10)4(9)2-7/h1,3-6,8-12H,2H2;2*1,3-5,7-10H,2H2/t3-,4+,5+,6+;2*3-,4+,5+/m000/s1 |
| InChIKey | TUCBOODBZIQAAG-MLNARXABSA-N |
| XLogP | -8.86 |
| TPSA | 314.20 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.42 |
| LogP ≤ 5 | -8.86 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|