C11H24O11 — CID 22593493
2,3,4,5,6-pentahydroxyhexanal;pentane-1,2,3,4,5-pentol (PubChem CID 22593493) has the molecular formula C11H24O11 and a molecular weight of 332.30 g/mol. Its IUPAC name is 2,3,4,5,6-pentahydroxyhexanal;pentane-1,2,3,4,5-pentol.
| Compound Name | 2,3,4,5,6-pentahydroxyhexanal;pentane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 22593493 |
| Molecular Formula | C11H24O11 |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2,3,4,5,6-pentahydroxyhexanal;pentane-1,2,3,4,5-pentol |
| SMILES | O=CC(O)C(O)C(O)C(O)CO.OCC(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H12O6.C5H12O5/c7-1-3(9)5(11)6(12)4(10)2-8;6-1-3(8)5(10)4(9)2-7/h1,3-6,8-12H,2H2;3-10H,1-2H2 |
| InChIKey | UHUZBXCDYJGKIY-UHFFFAOYSA-N |
| XLogP | -6.33 |
| TPSA | 219.37 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | -6.33 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|