C15H30O15 — CID 139557023
(2R,3S,4R)-2,3,4,5-tetrahydroxypentanal (PubChem CID 139557023) has the molecular formula C15H30O15 and a molecular weight of 450.39 g/mol. Its IUPAC name is (2R,3S,4R)-2,3,4,5-tetrahydroxypentanal.
| Compound Name | (2R,3S,4R)-2,3,4,5-tetrahydroxypentanal |
|---|---|
| PubChem CID | 139557023 |
| Molecular Formula | C15H30O15 |
| Molecular Weight | 450.39 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | (2R,3S,4R)-2,3,4,5-tetrahydroxypentanal |
| SMILES | O=C[C@H](O)[C@@H](O)[C@H](O)CO.O=C[C@H](O)[C@@H](O)[C@H](O)CO.O=C[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/3C5H10O5/c3*6-1-3(8)5(10)4(9)2-7/h3*1,3-5,7-10H,2H2/t3*3-,4+,5+/m000/s1 |
| InChIKey | JIEUNXTVLAWHMR-QZGFPUONSA-N |
| XLogP | -8.22 |
| TPSA | 293.97 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.39 |
| LogP ≤ 5 | -8.22 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|