C9H18O6 — CID 174814472
2,3,4,5,6-pentahydroxyhexanal;prop-1-ene (PubChem CID 174814472) has the molecular formula C9H18O6 and a molecular weight of 222.24 g/mol. Its IUPAC name is 2,3,4,5,6-pentahydroxyhexanal;prop-1-ene.
| Compound Name | 2,3,4,5,6-pentahydroxyhexanal;prop-1-ene |
|---|---|
| PubChem CID | 174814472 |
| Molecular Formula | C9H18O6 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 2,3,4,5,6-pentahydroxyhexanal;prop-1-ene |
| SMILES | C=CC.O=CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H12O6.C3H6/c7-1-3(9)5(11)6(12)4(10)2-8;1-3-2/h1,3-6,8-12H,2H2;3H,1H2,2H3 |
| InChIKey | AKSQUFPAJGWELT-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|