C7H16N2O6S — CID 174550729
2,3,4,5,6-pentahydroxyhexanal;thiourea (PubChem CID 174550729) has the molecular formula C7H16N2O6S and a molecular weight of 256.28 g/mol. Its IUPAC name is 2,3,4,5,6-pentahydroxyhexanal;thiourea.
| Compound Name | 2,3,4,5,6-pentahydroxyhexanal;thiourea |
|---|---|
| PubChem CID | 174550729 |
| Molecular Formula | C7H16N2O6S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 2,3,4,5,6-pentahydroxyhexanal;thiourea |
| SMILES | NC(N)=S.O=CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H12O6.CH4N2S/c7-1-3(9)5(11)6(12)4(10)2-8;2-1(3)4/h1,3-6,8-12H,2H2;(H4,2,3,4) |
| InChIKey | SHVSJTGOVUFSCR-UHFFFAOYSA-N |
| XLogP | -4.19 |
| TPSA | 170.26 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | -4.19 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|