C10H16O10 — CID 159896498
but-2-enedioic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal (PubChem CID 159896498) has the molecular formula C10H16O10 and a molecular weight of 296.23 g/mol. Its IUPAC name is but-2-enedioic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | but-2-enedioic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 159896498 |
| Molecular Formula | C10H16O10 |
| Molecular Weight | 296.23 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | but-2-enedioic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
| SMILES | O=C(O)C=CC(=O)O.O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O6.C4H4O4/c7-1-3(9)5(11)6(12)4(10)2-8;5-3(6)1-2-4(7)8/h1,3-6,8-12H,2H2;1-2H,(H,5,6)(H,7,8)/t3-,4+,5+,6+;/m0./s1 |
| InChIKey | NVKFYEBSUJWAIF-BTVCFUMJSA-N |
| XLogP | -3.67 |
| TPSA | 192.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.23 |
| LogP ≤ 5 | -3.67 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|