C6H15AlO6 — CID 174945571
alumane;2,3,4,5,6-pentahydroxyhexanal (PubChem CID 174945571) has the molecular formula C6H15AlO6 and a molecular weight of 210.16 g/mol. Its IUPAC name is alumane;2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | alumane;2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 174945571 |
| Molecular Formula | C6H15AlO6 |
| Molecular Weight | 210.16 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | alumane;2,3,4,5,6-pentahydroxyhexanal |
| SMILES | O=CC(O)C(O)C(O)C(O)CO.[AlH3] |
| InChI | InChI=1S/C6H12O6.Al.3H/c7-1-3(9)5(11)6(12)4(10)2-8;;;;/h1,3-6,8-12H,2H2;;;; |
| InChIKey | QQQZYZQSHZNHAP-UHFFFAOYSA-N |
| XLogP | -4.56 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.16 |
| LogP ≤ 5 | -4.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|