C12H25NO8 — CID 87866111
2-amino-4-methylpentanoic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal (PubChem CID 87866111) has the molecular formula C12H25NO8 and a molecular weight of 311.33 g/mol. Its IUPAC name is 2-amino-4-methylpentanoic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | 2-amino-4-methylpentanoic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 87866111 |
| Molecular Formula | C12H25NO8 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 2-amino-4-methylpentanoic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
| SMILES | CC(C)CC(N)C(=O)O.O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H13NO2.C6H12O6/c1-4(2)3-5(7)6(8)9;7-1-3(9)5(11)6(12)4(10)2-8/h4-5H,3,7H2,1-2H3,(H,8,9);1,3-6,8-12H,2H2/t;3-,4+,5+,6+/m.0/s1 |
| InChIKey | OXHDUMPNAUHUSI-SSPAHAAFSA-N |
| XLogP | -2.93 |
| TPSA | 181.54 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|