C11H26NO12P — CID 87244802
(2S)-2-amino-3-methylbutanoic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;phosphoric acid (PubChem CID 87244802) has the molecular formula C11H26NO12P and a molecular weight of 395.30 g/mol. Its IUPAC name is (2S)-2-amino-3-methylbutanoic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;phosphoric acid.
| Compound Name | (2S)-2-amino-3-methylbutanoic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;phosphoric acid |
|---|---|
| PubChem CID | 87244802 |
| Molecular Formula | C11H26NO12P |
| Molecular Weight | 395.30 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | (2S)-2-amino-3-methylbutanoic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;phosphoric acid |
| SMILES | CC(C)[C@H](N)C(=O)O.O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=P(O)(O)O |
| InChI | InChI=1S/C6H12O6.C5H11NO2.H3O4P/c7-1-3(9)5(11)6(12)4(10)2-8;1-3(2)4(6)5(7)8;1-5(2,3)4/h1,3-6,8-12H,2H2;3-4H,6H2,1-2H3,(H,7,8);(H3,1,2,3,4)/t3-,4+,5+,6+;4-;/m00./s1 |
| InChIKey | IWMLCRLRHUDLES-GDLJQJATSA-N |
| XLogP | -4.25 |
| TPSA | 259.30 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.30 |
| LogP ≤ 5 | -4.25 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|