C11H23NO7 — CID 87877287
(2S)-2-amino-3-methylbutanoic acid;(2R,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanal (PubChem CID 87877287) has the molecular formula C11H23NO7 and a molecular weight of 281.31 g/mol. Its IUPAC name is (2S)-2-amino-3-methylbutanoic acid;(2R,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanal.
| Compound Name | (2S)-2-amino-3-methylbutanoic acid;(2R,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanal |
|---|---|
| PubChem CID | 87877287 |
| Molecular Formula | C11H23NO7 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | (2S)-2-amino-3-methylbutanoic acid;(2R,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanal |
| SMILES | CC(C)[C@H](N)C(=O)O.C[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)C=O |
| InChI | InChI=1S/C6H12O5.C5H11NO2/c1-3(8)5(10)6(11)4(9)2-7;1-3(2)4(6)5(7)8/h2-6,8-11H,1H3;3-4H,6H2,1-2H3,(H,7,8)/t3-,4-,5-,6-;4-/m00/s1 |
| InChIKey | FOQOUOLEYJFMBQ-RDPFUJDXSA-N |
| XLogP | -2.30 |
| TPSA | 161.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|