C9H16O8 — CID 157349570
2-oxopropanoic acid;(2R,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanal (PubChem CID 157349570) has the molecular formula C9H16O8 and a molecular weight of 252.22 g/mol. Its IUPAC name is 2-oxopropanoic acid;(2R,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanal.
| Compound Name | 2-oxopropanoic acid;(2R,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanal |
|---|---|
| PubChem CID | 157349570 |
| Molecular Formula | C9H16O8 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 2-oxopropanoic acid;(2R,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanal |
| SMILES | CC(=O)C(=O)O.C[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)C=O |
| InChI | InChI=1S/C6H12O5.C3H4O3/c1-3(8)5(10)6(11)4(9)2-7;1-2(4)3(5)6/h2-6,8-11H,1H3;1H3,(H,5,6)/t3-,4-,5-,6-;/m0./s1 |
| InChIKey | BHJHVWOIMORCBX-DEZHIRTDSA-N |
| XLogP | -2.69 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|