C11H22O10 — CID 87725092
(2R,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanal;(2S,3R,4R)-2,3,4,5-tetrahydroxypentanal (PubChem CID 87725092) has the molecular formula C11H22O10 and a molecular weight of 314.29 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanal;(2S,3R,4R)-2,3,4,5-tetrahydroxypentanal.
| Compound Name | (2R,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanal;(2S,3R,4R)-2,3,4,5-tetrahydroxypentanal |
|---|---|
| PubChem CID | 87725092 |
| Molecular Formula | C11H22O10 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (2R,3R,4S,5S)-2,3,4,5-tetrahydroxyhexanal;(2S,3R,4R)-2,3,4,5-tetrahydroxypentanal |
| SMILES | C[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)C=O.O=C[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O5.C5H10O5/c1-3(8)5(10)6(11)4(9)2-7;6-1-3(8)5(10)4(9)2-7/h2-6,8-11H,1H3;1,3-5,7-10H,2H2/t3-,4-,5-,6-;3-,4-,5+/m01/s1 |
| InChIKey | QMYDHJSXOZCPFF-DPZOSDGHSA-N |
| XLogP | -5.09 |
| TPSA | 195.98 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | -5.09 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|